EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N6O7P |
| Net Charge | 0 |
| Average Mass | 400.288 |
| Monoisotopic Mass | 400.08963 |
| SMILES | CN1N=C(N)c2cn([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c3ncnc1c23 |
| InChI | InChI=1S/C13H17N6O7P/c1-18-11-7-5(10(14)17-18)2-19(12(7)16-4-15-11)13-9(21)8(20)6(26-13)3-25-27(22,23)24/h2,4,6,8-9,13,20-21H,3H2,1H3,(H2,14,17)(H2,22,23,24)/t6-,8-,9-,13-/m1/s1 |
| InChIKey | URLYINUFLXOMHP-HTVVRFAVSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triciribine phosphate (CHEBI:748887) has role antineoplastic agent (CHEBI:35610) |
| triciribine phosphate (CHEBI:748887) is a nucleobase-containing molecular entity (CHEBI:61120) |
| INNs | Source |
|---|---|
| triciribina | WHO MedNet |
| triciribine | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-154020 | ChEMBL |
| NSC-280594 | ChEMBL |
| Phosphate salt of tricyclic nucleoside | ChEMBL |
| Triciribine phosphate | ChEMBL |
| Vqd-002 | ChEMBL |
| Citations |
|---|