EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO7S |
| Net Charge | 0 |
| Average Mass | 399.465 |
| Monoisotopic Mass | 399.13517 |
| SMILES | COCCOCCOCCOc1cccc(C2=N[C@@](C)(C(=O)O)CS2)c1O |
| InChI | InChI=1S/C18H25NO7S/c1-18(17(21)22)12-27-16(19-18)13-4-3-5-14(15(13)20)26-11-10-25-9-8-24-7-6-23-2/h3-5,20H,6-12H2,1-2H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | AWHIMFSHNAAMBM-GOSISDBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deferitazole (CHEBI:748884) is a α-amino acid (CHEBI:33704) |
| INNs | Source |
|---|---|
| deferitazol | WHO MedNet |
| deferitazole | WHO MedNet |
| Synonyms | Source |
|---|---|
| FBS-0701 | ChEMBL |
| FBS0701 | ChEMBL |
| SPD-602 | ChEMBL |
| SPD602 | ChEMBL |
| Brand Name | Source |
|---|---|
| Fbs0701, spd602 | ChEMBL |
| Citations |
|---|