EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N4O2 |
| Net Charge | 0 |
| Average Mass | 397.485 |
| Monoisotopic Mass | 397.21434 |
| SMILES | CCN(CC)C(=O)Cc1c(-c2ccc(OCC[18F])cc2)nn2c(C)cc(C)nc12 |
| InChI | InChI=1S/C22H27FN4O2/c1-5-26(6-2)20(28)14-19-21(17-7-9-18(10-8-17)29-12-11-23)25-27-16(4)13-15(3)24-22(19)27/h7-10,13H,5-6,11-12,14H2,1-4H3/i23-1 |
| InChIKey | FLZZFWBNYJNHMY-VNRZBHCFSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dpa-714 f-18 (CHEBI:748880) has role antifibrotic agent (CHEBI:233423) |
| dpa-714 f-18 (CHEBI:748880) has role antiparkinson drug (CHEBI:48407) |
| dpa-714 f-18 (CHEBI:748880) has role antiviral agent (CHEBI:22587) |
| dpa-714 f-18 (CHEBI:748880) is a pyrazoles (CHEBI:26410) |
| dpa-714 f-18 (CHEBI:748880) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| [18f]dpa-714 | ChEMBL |
| 18f-dpa-714 | ChEMBL |
| (18F)DPA-714 | ChEMBL |
| BAY85-8102 | ChEMBL |
| BAY858102 | ChEMBL |
| Dpa-714 f-18 | ChEMBL |
| Citations |
|---|