EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748877 - bms-707035
| Formula | C17H19FN4O5S |
| Net Charge | 0 |
| Average Mass | 410.427 |
| Monoisotopic Mass | 410.10602 |
| SMILES | Cn1c(N2CCCCS2(=O)=O)nc(C(=O)NCc2ccc(F)cc2)c(O)c1=O |
| InChI | InChI=1S/C17H19FN4O5S/c1-21-16(25)14(23)13(15(24)19-10-11-4-6-12(18)7-5-11)20-17(21)22-8-2-3-9-28(22,26)27/h4-7,23H,2-3,8-10H2,1H3,(H,19,24) |
| InChIKey | VNIWZCGZPBJWBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-707035 (CHEBI:748877) has role anti-HIV agent (CHEBI:64946) |
| bms-707035 (CHEBI:748877) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Synonyms | Source |
|---|---|
| Bms 707035 | ChEMBL |
| Bms-707035 | ChEMBL |
| Citations |
|---|