EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748873 - bvt.115959
| Formula | C11H15N5O5 |
| Net Charge | 0 |
| Average Mass | 297.271 |
| Monoisotopic Mass | 297.10732 |
| SMILES | COc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C11H15N5O5/c1-20-11-14-8(12)5-9(15-11)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | AJACDNCVEGIBNA-KQYNXXCUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bvt.115959 (CHEBI:748873) is a purine nucleoside (CHEBI:26394) |
| Synonyms | Source |
|---|---|
| Bvt.115959 | ChEMBL |
| Spongosine | ChEMBL |
| Citations |
|---|