EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748872 - d-limonene
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C(C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| InChIKey | XMGQYMWWDOXHJM-JTQLQIEISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| d-limonene (CHEBI:748872) is a monoterpenoid (CHEBI:25409) |
| Synonyms | Source |
|---|---|
| Cinene | ChEMBL |
| Dipenten | ChEMBL |
| Dipentene no. 122 | ChEMBL |
| (d)-limonene | ChEMBL |
| Eulimen | ChEMBL |
| FEMA NO. 2633 | ChEMBL |
| Citations |
|---|