EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N4O3 |
| Net Charge | 0 |
| Average Mass | 264.285 |
| Monoisotopic Mass | 264.12224 |
| SMILES | O=c1ncnc2c(CN3C[C@H](CO)[C@@H](O)C3)cnc12 |
| InChI | InChI=1S/C12H16N4O3/c17-5-8-3-16(4-9(8)18)2-7-1-13-11-10(7)14-6-15-12(11)19/h1,6,8-9,13,17-18H,2-5H2,(H,14,15,19)/t8-,9+/m1/s1 |
| InChIKey | AFNHHLILYQEHKK-BDAKNGLRSA-N |
| Roles Classification |
|---|
| Application: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulodesine (CHEBI:748869) has role gout suppressant (CHEBI:35845) |
| ulodesine (CHEBI:748869) is a pyrrolopyrimidine (CHEBI:38670) |
| INNs | Source |
|---|---|
| ulodesina | WHO MedNet |
| ulodesine | WHO MedNet |
| Synonyms | Source |
|---|---|
| BCX-3408 | ChEMBL |
| BCX4208 | ChEMBL |
| Dadme-immucillin h | ChEMBL |
| LR-09 | ChEMBL |
| R-3421 | ChEMBL |
| Brand Name | Source |
|---|---|
| Bcx-4208 | ChEMBL |
| Citations |
|---|