EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24NO8P |
| Net Charge | 0 |
| Average Mass | 437.385 |
| Monoisotopic Mass | 437.12395 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OP(=O)(O)O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C20H24NO8P/c1-11(22)21-16-8-5-12-9-17(26-2)19(27-3)20(28-4)18(12)14-7-6-13(10-15(14)16)29-30(23,24)25/h6-7,9-10,16H,5,8H2,1-4H3,(H,21,22)(H2,23,24,25)/t16-/m0/s1 |
| InChIKey | UGBMEXLBFDAOGL-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zd-6126 (CHEBI:748865) has role antineoplastic agent (CHEBI:35610) |
| zd-6126 (CHEBI:748865) is a acetamides (CHEBI:22160) |
| zd-6126 (CHEBI:748865) is a alkaloid (CHEBI:22315) |
| zd-6126 (CHEBI:748865) is a carbotricyclic compound (CHEBI:38032) |
| Synonyms | Source |
|---|---|
| ANG 453 | ChEMBL |
| ANG-453 | ChEMBL |
| AZD 6126 | ChEMBL |
| AZD-6126 | ChEMBL |
| Zd-6126 | ChEMBL |
| Zd6126 | ChEMBL |
| Citations |
|---|