EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16N4O2S |
| Net Charge | 0 |
| Average Mass | 400.463 |
| Monoisotopic Mass | 400.09940 |
| SMILES | Cc1cc(NC(=O)C(=O)c2cc(Cc3ccc(C#N)cc3)n3ccccc23)sn1 |
| InChI | InChI=1S/C22H16N4O2S/c1-14-10-20(29-25-14)24-22(28)21(27)18-12-17(26-9-3-2-4-19(18)26)11-15-5-7-16(13-23)8-6-15/h2-10,12H,11H2,1H3,(H,24,28) |
| InChIKey | IZZYUABKZYIINT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosabulin (CHEBI:748858) has role antineoplastic agent (CHEBI:35610) |
| rosabulin (CHEBI:748858) is a indolizines (CHEBI:38485) |
| INNs | Source |
|---|---|
| rosabulin | WHO MedNet |
| rosabulina | WHO MedNet |
| rosabuline | WHO MedNet |
| Synonym | Source |
|---|---|
| STA-5312 | ChEMBL |
| Citations |
|---|