EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10FIN2O5 |
| Net Charge | 0 |
| Average Mass | 372.090 |
| Monoisotopic Mass | 371.96185 |
| SMILES | O=c1nc(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2F)cc1I |
| InChI | InChI=1S/C9H10FIN2O5/c10-5-6(15)4(2-14)18-8(5)13-1-3(11)7(16)12-9(13)17/h1,4-6,8,14-15H,2H2,(H,12,16,17)/t4-,5+,6-,8-/m1/s1 |
| InChIKey | IPVFGAYTKQKGBM-BYPJNBLXSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fialuridine (CHEBI:748854) has role anti-HBV agent (CHEBI:64951) |
| fialuridine (CHEBI:748854) is a pyrimidine nucleoside (CHEBI:26440) |
| INNs | Source |
|---|---|
| fialuridina | WHO MedNet |
| fialuridine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fiau | ChEMBL |
| NSC-678514 | ChEMBL |
| Citations |
|---|