EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C22H23N6O8P.Na |
| Net Charge | 0 |
| Average Mass | 576.414 |
| Monoisotopic Mass | 576.11104 |
| SMILES | [H][C@@]12O[C@@H](/C=C/c3ccccc3)O[C@]1([H])[C@@H](COP(=O)([O-])[O-])O[C@H]2n1cnc2c(NC(=O)NCC)ncnc21.[Na+].[Na+] |
| InChI | InChI=1S/C22H25N6O8P.2Na/c1-2-23-22(29)27-19-16-20(25-11-24-19)28(12-26-16)21-18-17(14(34-21)10-33-37(30,31)32)35-15(36-18)9-8-13-6-4-3-5-7-13;;/h3-9,11-12,14-15,17-18,21H,2,10H2,1H3,(H2,30,31,32)(H2,23,24,25,27,29);;/q;2*+1/p-2/b9-8+;;/t14-,15+,17-,18-,21-;;/m1../s1 |
| InChIKey | MKQKPLQMNCXTJE-VEZQGTPESA-L |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| regrelor disodium (CHEBI:748853) has role cardiovascular drug (CHEBI:35554) |
| regrelor disodium (CHEBI:748853) is a purine ribonucleoside monophosphate (CHEBI:26397) |
| Synonyms | Source |
|---|---|
| INS-50589 | ChEMBL |
| INS50589 | ChEMBL |
| Regrelor disodium | ChEMBL |
| Citations |
|---|