EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35NO4 |
| Net Charge | 0 |
| Average Mass | 449.591 |
| Monoisotopic Mass | 449.25661 |
| SMILES | [H][C@@]12CC[C@](COC)(OC)[C@@]1(C)C[C@H](c1ccc(/C=N/O)cc1)C1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C28H35NO4/c1-27-15-24(19-6-4-18(5-7-19)16-29-31)26-22-11-9-21(30)14-20(22)8-10-23(26)25(27)12-13-28(27,33-3)17-32-2/h4-7,14,16,23-25,31H,8-13,15,17H2,1-3H3/b29-16+/t23-,24+,25-,27-,28+/m0/s1 |
| InChIKey | GJMNAFGEUJBOCE-MEQIQULJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asoprisnil (CHEBI:748849) has role antineoplastic agent (CHEBI:35610) |
| asoprisnil (CHEBI:748849) is a oxo steroid (CHEBI:35789) |
| INN | Source |
|---|---|
| asoprisnilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| Asoprisnil | ChEMBL |
| BAY86-5294 | ChEMBL |
| J-867 | ChEMBL |
| J867 | ChEMBL |
| Citations |
|---|