EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20Cl2N4O2S |
| Net Charge | 0 |
| Average Mass | 487.412 |
| Monoisotopic Mass | 486.06840 |
| SMILES | CN/C(=N\S(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H20Cl2N4O2S/c1-26-23(28-32(30,31)20-13-11-19(25)12-14-20)29-15-21(16-5-3-2-4-6-16)22(27-29)17-7-9-18(24)10-8-17/h2-14,21H,15H2,1H3,(H,26,28)/t21-/m1/s1 |
| InChIKey | AXJQVVLKUYCICH-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibipinabant (CHEBI:748845) has role anti-obesity agent (CHEBI:74518) |
| ibipinabant (CHEBI:748845) has role hypoglycemic agent (CHEBI:35526) |
| ibipinabant (CHEBI:748845) is a stilbenoid (CHEBI:26776) |
| INN | Source |
|---|---|
| ibipinabant | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS-646256 | ChEMBL |
| Slv319 | ChEMBL |
| SLV-319 | ChEMBL |
| Citations |
|---|