EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O6S.C22H21ClN2O8 |
| Net Charge | 0 |
| Average Mass | 695.055 |
| Monoisotopic Mass | 694.08715 |
| SMILES | O=C(O)c1cc(S(=O)(=O)O)ccc1O.[H][C@@]12C(=C)c3c(Cl)ccc(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]1([H])[C@H]2O |
| InChI | InChI=1S/C22H21ClN2O8.C7H6O6S/c1-6-9-7(23)4-5-8(26)11(9)16(27)12-10(6)17(28)14-15(25(2)3)18(29)13(21(24)32)20(31)22(14,33)19(12)30;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h4-5,10,14-15,17,26,28-30,33H,1H2,2-3H3,(H2,24,32);1-3,8H,(H,9,10)(H,11,12,13)/t10-,14-,15+,17+,22+;/m1./s1 |
| InChIKey | FYSVKUUNXYGFLA-CCHMMTNSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meclocycline sulfosalicylate (CHEBI:748844) has role anti-inflammatory agent (CHEBI:67079) |
| meclocycline sulfosalicylate (CHEBI:748844) is a tetracyclines (CHEBI:26895) |
| Synonyms | Source |
|---|---|
| Meclocycline 5-sulfosalicylate | ChEMBL |
| Meclocyline sulfosalicylate | ChEMBL |
| NSC-757831 | ChEMBL |
| SNX-1012 | ChEMBL |
| Brand Names | Source |
|---|---|
| Meclocil | ChEMBL |
| Mecloderm | ChEMBL |
| Meclosorb | ChEMBL |
| Quoderm | ChEMBL |
| Traumatociclina | ChEMBL |
| Citations |
|---|