EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 388.254 |
| Monoisotopic Mass | 387.05413 |
| SMILES | Cc1cc(/C(=C/Nc2ccc(Cl)cc2)C(=O)Nc2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C19H15Cl2N3O2/c1-12-10-18(26-24-12)17(11-22-15-6-2-13(20)3-7-15)19(25)23-16-8-4-14(21)5-9-16/h2-11,22H,1H3,(H,23,25)/b17-11- |
| InChIKey | VMAKIACTLSBBIY-BOPFTXTBSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avl-3288 (CHEBI:748838) has role antipsychotic agent (CHEBI:35476) |
| avl-3288 (CHEBI:748838) is a anilide (CHEBI:13248) |
| Synonyms | Source |
|---|---|
| Anvylic-3288 | ChEMBL |
| Avl-3288 | ChEMBL |
| CCMI | ChEMBL |
| UCI-4083 | ChEMBL |
| XY-4083 | ChEMBL |
| Citations |
|---|