EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24BrF2N5O3S |
| Net Charge | 0 |
| Average Mass | 532.411 |
| Monoisotopic Mass | 531.07513 |
| SMILES | NC(=O)c1c(OCc2c(F)cc(Br)cc2F)nsc1NC(=O)NCCCCN1CCCC1 |
| InChI | InChI=1S/C20H24BrF2N5O3S/c21-12-9-14(22)13(15(23)10-12)11-31-18-16(17(24)29)19(32-27-18)26-20(30)25-5-1-2-6-28-7-3-4-8-28/h9-10H,1-8,11H2,(H2,24,29)(H2,25,26,30) |
| InChIKey | HXHAJRMTJXHJJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osi-632 (CHEBI:748833) has role antineoplastic agent (CHEBI:35610) |
| osi-632 (CHEBI:748833) has role ophthalmology drug (CHEBI:66981) |
| osi-632 (CHEBI:748833) is a aromatic amide (CHEBI:62733) |
| osi-632 (CHEBI:748833) is a thiazoles (CHEBI:48901) |
| Synonyms | Source |
|---|---|
| CP-547,632 | ChEMBL |
| CP-547632 | ChEMBL |
| CP-632 | ChEMBL |
| OSI-632 | ChEMBL |
| PAN 90806 | ChEMBL |
| PAN-90806 | ChEMBL |
| Citations |
|---|