EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O6 |
| Net Charge | 0 |
| Average Mass | 310.306 |
| Monoisotopic Mass | 310.11649 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O6/c15-10(7-8-1-3-9(17)4-2-8)13(20)16-11(14(21)22)5-6-12(18)19/h1-4,10-11,17H,5-7,15H2,(H,16,20)(H,18,19)(H,21,22)/t10-,11-/m0/s1 |
| InChIKey | PDSLRCZINIDLMU-QWRGUYRKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Glu (CHEBI:74883) has role metabolite (CHEBI:25212) |
| Tyr-Glu (CHEBI:74883) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tyrosyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| L-Tyr-L-Glu | ChEBI |
| Tyrosyl-Glutamate | ChEBI |
| tyrosylglutamic acid | ChEBI |
| YE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029104 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2951967 | Reaxys |