EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16BrClFN3OS |
| Net Charge | 0 |
| Average Mass | 432.746 |
| Monoisotopic Mass | 430.98700 |
| SMILES | CCOc1ccc(F)c(CCNC(=S)Nc2ccc(Br)cn2)c1Cl |
| InChI | InChI=1S/C16H16BrClFN3OS/c1-2-23-13-5-4-12(19)11(15(13)18)7-8-20-16(24)22-14-6-3-10(17)9-21-14/h3-6,9H,2,7-8H2,1H3,(H2,20,21,22,24) |
| InChIKey | DTHZUSMREBJMBT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiourea, n-(5-bromo-2-pyridinyl)-n'-(2-(2-chloro-3-ethoxy-6-fluorophenyl)ethyl)- (CHEBI:748826) has role antineoplastic agent (CHEBI:35610) |
| thiourea, n-(5-bromo-2-pyridinyl)-n'-(2-(2-chloro-3-ethoxy-6-fluorophenyl)ethyl)- (CHEBI:748826) is a aromatic ether (CHEBI:35618) |
| Synonym | Source |
|---|---|
| Thiourea, n-(5-bromo-2-pyridinyl)-n'-(2-(2-chloro-3-ethoxy-6-fluorophenyl)ethyl)- | ChEMBL |
| Citations |
|---|