EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4FNO2 |
| Net Charge | 0 |
| Average Mass | 141.101 |
| Monoisotopic Mass | 141.02261 |
| SMILES | O=C(O)c1cncc(F)c1 |
| InChI | InChI=1S/C6H4FNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10) |
| InChIKey | BXZSBDDOYIWMGC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-fluoronicotinic acid (CHEBI:748816) has role antineoplastic agent (CHEBI:35610) |
| 5-fluoronicotinic acid (CHEBI:748816) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| 5-fluoro-3-pyridinecarboxylic acid | ChEMBL |
| 5-fluoronicotinic acid | ChEMBL |
| Citations |
|---|