EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N9O3 |
| Net Charge | 0 |
| Average Mass | 503.567 |
| Monoisotopic Mass | 503.23934 |
| SMILES | COCCOc1ccc(N2CCN(CCn3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C25H29N9O3/c1-35-15-16-36-19-6-4-18(5-7-19)32-11-8-31(9-12-32)10-13-33-23-20(17-27-33)24-28-22(21-3-2-14-37-21)30-34(24)25(26)29-23/h2-7,14,17H,8-13,15-16H2,1H3,(H2,26,29) |
| InChIKey | DTYWJKSSUANMHD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| preladenant (CHEBI:748815) has role antineoplastic agent (CHEBI:35610) |
| preladenant (CHEBI:748815) has role antiparkinson drug (CHEBI:48407) |
| preladenant (CHEBI:748815) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| preladenant | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-3814 | ChEMBL |
| SCH 420814 | ChEMBL |
| SCH-420814 | ChEMBL |
| Citations |
|---|