EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H37N7O4 |
| Net Charge | 0 |
| Average Mass | 631.737 |
| Monoisotopic Mass | 631.29070 |
| SMILES | Cn1cc(NC(=O)c2cc(NC(=O)c3ccc(/C=C/c4cnc5ccccc5c4)cc3)cn2C)cc1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C36H37N7O4/c1-41-24-30(20-32(41)35(45)37-13-14-43-15-17-47-18-16-43)40-36(46)33-21-29(23-42(33)2)39-34(44)27-11-9-25(10-12-27)7-8-26-19-28-5-3-4-6-31(28)38-22-26/h3-12,19-24H,13-18H2,1-2H3,(H,37,45)(H,39,44)(H,40,46)/b8-7+ |
| InChIKey | OEKXCVYZBVOWBR-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mgb-bp-3 (CHEBI:748805) has role antibacterial agent (CHEBI:33282) |
| mgb-bp-3 (CHEBI:748805) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| J2.725.402K | ChEMBL |
| Mgb-bp3 | ChEMBL |
| MGB-BP-3 | ChEMBL |
| Citations |
|---|