EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27F5N6O3 |
| Net Charge | 0 |
| Average Mass | 566.531 |
| Monoisotopic Mass | 566.20648 |
| SMILES | O=C(N[C@@H]1CC[C@@H](c2cccc(F)c2F)CN(CC(F)(F)F)C1=O)N1CCC(n2c(=O)nc3ncccc32)CC1 |
| InChI | InChI=1S/C26H27F5N6O3/c27-18-4-1-3-17(21(18)28)15-6-7-19(23(38)36(13-15)14-26(29,30)31)33-24(39)35-11-8-16(9-12-35)37-20-5-2-10-32-22(20)34-25(37)40/h1-5,10,15-16,19H,6-9,11-14H2,(H,33,39)(H,32,34,40)/t15-,19-/m1/s1 |
| InChIKey | CGDZXLJGHVKVIE-DNVCBOLYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telcagepant (CHEBI:748803) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| telcagepant | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-0974 | ChEMBL |
| MK0974 | ChEMBL |
| Citations |
|---|