EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N5O5 |
| Net Charge | 0 |
| Average Mass | 337.336 |
| Monoisotopic Mass | 337.13862 |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N[C@@H]4CCOC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19N5O5/c20-3-8-10(21)11(22)14(24-8)19-6-17-9-12(15-5-16-13(9)19)18-7-1-2-23-4-7/h5-8,10-11,14,20-22H,1-4H2,(H,15,16,18)/t7-,8-,10-,11-,14-/m1/s1 |
| InChIKey | OESBDSFYJMDRJY-BAYCTPFLSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tecadenoson (CHEBI:748802) has role anti-arrhythmia drug (CHEBI:38070) |
| tecadenoson (CHEBI:748802) is a purine nucleoside (CHEBI:26394) |
| INN | Source |
|---|---|
| tecadenoson | WHO MedNet |
| Synonym | Source |
|---|---|
| CVT-510 | ChEMBL |
| Citations |
|---|