EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748801 - valopicitabine
| Formula | C15H24N4O6 |
| Net Charge | 0 |
| Average Mass | 356.379 |
| Monoisotopic Mass | 356.16958 |
| SMILES | CC(C)[C@H](N)C(=O)O[C@@H]1[C@@H](CO)O[C@@H](n2ccc(N)nc2=O)[C@]1(C)O |
| InChI | InChI=1S/C15H24N4O6/c1-7(2)10(17)12(21)25-11-8(6-20)24-13(15(11,3)23)19-5-4-9(16)18-14(19)22/h4-5,7-8,10-11,13,20,23H,6,17H2,1-3H3,(H2,16,18,22)/t8-,10+,11-,13-,15-/m1/s1 |
| InChIKey | TVRCRTJYMVTEFS-ICGCPXGVSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valopicitabine (CHEBI:748801) has role antiviral agent (CHEBI:22587) |
| valopicitabine (CHEBI:748801) is a pyrimidine nucleoside (CHEBI:26440) |
| INNs | Source |
|---|---|
| valopicitabina | WHO MedNet |
| valopicitabine | WHO MedNet |
| Synonym | Source |
|---|---|
| NM-283 | ChEMBL |
| Citations |
|---|