EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H29N3 |
| Net Charge | 0 |
| Average Mass | 227.396 |
| Monoisotopic Mass | 227.23615 |
| SMILES | CCCCCCCCCCCCNC(=N)N |
| InChI | InChI=1S/C13H29N3/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15/h2-12H2,1H3,(H4,14,15,16) |
| InChIKey | HILAYQUKKYWPJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-dodecylguanidine (CHEBI:74880) has part dodecyl group (CHEBI:23870) |
| 1-dodecylguanidine (CHEBI:74880) has part guanidino group (CHEBI:48551) |
| 1-dodecylguanidine (CHEBI:74880) has role antibacterial agent (CHEBI:33282) |
| 1-dodecylguanidine (CHEBI:74880) has role antifungal agrochemical (CHEBI:86328) |
| 1-dodecylguanidine (CHEBI:74880) is a aliphatic nitrogen antifungal agent (CHEBI:86417) |
| 1-dodecylguanidine (CHEBI:74880) is a guanidines (CHEBI:24436) |
| 1-dodecylguanidine (CHEBI:74880) is conjugate base of 1-dodecylguanidine(1+) (CHEBI:74887) |
| Incoming Relation(s) |
| 1-dodecylguanidine(1+) (CHEBI:74887) is conjugate acid of 1-dodecylguanidine (CHEBI:74880) |
| IUPAC Name |
|---|
| 1-dodecylguanidine |
| Synonyms | Source |
|---|---|
| 1-laurylguanidine | ChEBI |
| C12-G | ChEBI |
| dodecylguanidine | ChemIDplus |
| n-dodecylguanidine | ChEBI |
| laurylguanidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:637515 | Reaxys |
| CAS:112-65-2 | ChemIDplus |
| Citations |
|---|