EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H29N3 |
| Net Charge | 0 |
| Average Mass | 227.396 |
| Monoisotopic Mass | 227.23615 |
| SMILES | CCCCCCCCCCCCNC(=N)N |
| InChI | InChI=1S/C13H29N3/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15/h2-12H2,1H3,(H4,14,15,16) |
| InChIKey | HILAYQUKKYWPJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-dodecylguanidine (CHEBI:74880) has part dodecyl group (CHEBI:23870) |
| 1-dodecylguanidine (CHEBI:74880) has part guanidino group (CHEBI:48551) |
| 1-dodecylguanidine (CHEBI:74880) has role antibacterial agent (CHEBI:33282) |
| 1-dodecylguanidine (CHEBI:74880) has role antifungal agrochemical (CHEBI:86328) |
| 1-dodecylguanidine (CHEBI:74880) is a aliphatic nitrogen antifungal agent (CHEBI:86417) |
| 1-dodecylguanidine (CHEBI:74880) is a guanidines (CHEBI:24436) |
| 1-dodecylguanidine (CHEBI:74880) is conjugate base of 1-dodecylguanidine(1+) (CHEBI:74887) |
| Incoming Relation(s) |
| 1-dodecylguanidine(1+) (CHEBI:74887) is conjugate acid of 1-dodecylguanidine (CHEBI:74880) |
| IUPAC Name |
|---|
| 1-dodecylguanidine |
| Synonyms | Source |
|---|---|
| dodecylguanidine | ChemIDplus |
| n-dodecylguanidine | ChEBI |
| C12-G | ChEBI |
| laurylguanidine | ChEBI |
| 1-laurylguanidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:637515 | Reaxys |
| CAS:112-65-2 | ChemIDplus |
| Citations |
|---|