EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H47NO13 |
| Net Charge | 0 |
| Average Mass | 665.733 |
| Monoisotopic Mass | 665.30474 |
| SMILES | [H][C@@]12C[C@H](O)C[C@]3(O)C[C@H](O)[C@@H](C(=O)O)[C@]([H])(C[C@@H](O[C@@H]4O[C@H](C)[C@@H](O)[C@H](N)[C@@H]4O)/C=C/C=C/C=C/C=C/C[C@@H](C)OC(=O)/C=C/[C@H]1O2)O3 |
| InChI | InChI=1S/C33H47NO13/c1-18-10-8-6-4-3-5-7-9-11-21(45-32-30(39)28(34)29(38)19(2)44-32)15-25-27(31(40)41)22(36)17-33(42,47-25)16-20(35)14-24-23(46-24)12-13-26(37)43-18/h3-9,11-13,18-25,27-30,32,35-36,38-39,42H,10,14-17,34H2,1-2H3,(H,40,41)/b4-3+,7-5+,8-6+,11-9+,13-12+/t18-,19-,20+,21+,22+,23-,24-,25+,27-,28+,29-,30+,32+,33-/m1/s1 |
| InChIKey | NCXMLFZGDNKEPB-FFPOYIOWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces natalensis (ncbitaxon:68242) | - | PubMed (31311527) |
| Roles Classification |
|---|
| Chemical Roles: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| natamycin (CHEBI:7488) has role antifungal agrochemical (CHEBI:86328) |
| natamycin (CHEBI:7488) has role antimicrobial food preservative (CHEBI:65256) |
| natamycin (CHEBI:7488) has role apoptosis inducer (CHEBI:68495) |
| natamycin (CHEBI:7488) has role bacterial metabolite (CHEBI:76969) |
| natamycin (CHEBI:7488) has role ophthalmology drug (CHEBI:66981) |
| natamycin (CHEBI:7488) is a antibiotic antifungal drug (CHEBI:87113) |
| natamycin (CHEBI:7488) is a dicarboxylic acid monoester (CHEBI:36244) |
| natamycin (CHEBI:7488) is a epoxide (CHEBI:32955) |
| natamycin (CHEBI:7488) is a macrolide antibiotic (CHEBI:25105) |
| natamycin (CHEBI:7488) is a monosaccharide derivative (CHEBI:63367) |
| natamycin (CHEBI:7488) is a polyene antibiotic (CHEBI:26177) |
| IUPAC Name |
|---|
| (1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.05,7]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid |
| INNs | Source |
|---|---|
| natamicina | WHO MedNet |
| natamycin | WHO MedNet |
| natamycine | WHO MedNet |
| natamycinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| antibiotic A-5283 | ChemIDplus |
| CL 12,625 | ChemIDplus |
| CL 12625 | ChemIDplus |
| E 235 | ChEBI |
| E-235 | ChEBI |
| pimaricin | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Delvocid | ChemIDplus |
| Delvolan | ChemIDplus |
| Delvopos | ChemIDplus |
| Mycophyt | ChemIDplus |
| Myprozine | ChemIDplus |
| Myuprozine | DrugCentral |
| Citations |
|---|