EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H33F3N4O3 |
| Net Charge | 0 |
| Average Mass | 674.723 |
| Monoisotopic Mass | 674.25048 |
| SMILES | CN(Cc1ccccc1)C(=O)[C@@H](NC(=O)c1cc2cc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)ccc2n1C)c1ccccc1 |
| InChI | InChI=1S/C40H33F3N4O3/c1-46(25-26-11-5-3-6-12-26)39(50)36(28-13-7-4-8-14-28)45-38(49)35-24-29-23-31(21-22-34(29)47(35)2)44-37(48)33-16-10-9-15-32(33)27-17-19-30(20-18-27)40(41,42)43/h3-24,36H,25H2,1-2H3,(H,44,48)(H,45,49)/t36-/m0/s1 |
| InChIKey | TUOSYWCFRFNJBS-BHVANESWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dirlotapide (CHEBI:748799) has role anti-obesity agent (CHEBI:74518) |
| dirlotapide (CHEBI:748799) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| dirlotapida | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP-742,033 | ChEMBL |
| CP-742033 | ChEMBL |
| Dirlotapide | ChEMBL |
| Slentrol | ChEMBL |
| Citations |
|---|