EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O3 |
| Net Charge | 0 |
| Average Mass | 265.273 |
| Monoisotopic Mass | 265.11749 |
| SMILES | COc1nc(N)nc2c1ncn2[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C11H15N5O3/c1-18-10-8-9(14-11(12)15-10)16(5-13-8)7-3-2-6(4-17)19-7/h5-7,17H,2-4H2,1H3,(H2,12,14,15)/t6-,7+/m0/s1 |
| InChIKey | FJAOCNGVPLTSLD-NKWVEPMBSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metacavir (CHEBI:748787) has role anti-HBV agent (CHEBI:64951) |
| metacavir (CHEBI:748787) is a purines (CHEBI:26401) |
| Synonym | Source |
|---|---|
| Metacavir | ChEMBL |
| Citations |
|---|