EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748784 - seladelpar
| Formula | C21H23F3O5S |
| Net Charge | 0 |
| Average Mass | 444.471 |
| Monoisotopic Mass | 444.12183 |
| SMILES | CCO[C@H](COc1ccc(C(F)(F)F)cc1)CSc1ccc(OCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C21H23F3O5S/c1-3-27-17(11-28-16-6-4-15(5-7-16)21(22,23)24)13-30-18-8-9-19(14(2)10-18)29-12-20(25)26/h4-10,17H,3,11-13H2,1-2H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | JWHYSEDOYMYMNM-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seladelpar (CHEBI:748784) has role anticholesteremic drug (CHEBI:35821) |
| seladelpar (CHEBI:748784) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| (+)-MBX-8025 | ChEMBL |
| MBX-8025 | ChEMBL |
| RWJ-800025 | ChEMBL |
| Seladelpar | ChEMBL |
| Citations |
|---|