EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H29NO4S |
| Net Charge | 0 |
| Average Mass | 475.610 |
| Monoisotopic Mass | 475.18173 |
| SMILES | COc1ccc(-c2sc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H29NO4S/c1-31-22-8-5-20(6-9-22)28-27(25-14-7-21(30)19-26(25)34-28)33-24-12-10-23(11-13-24)32-18-17-29-15-3-2-4-16-29/h5-14,19,30H,2-4,15-18H2,1H3 |
| InChIKey | MCGDSOGUHLTADD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arzoxifene (CHEBI:748781) has role antineoplastic agent (CHEBI:35610) |
| arzoxifene (CHEBI:748781) has role bone density conservation agent (CHEBI:50646) |
| arzoxifene (CHEBI:748781) is a aromatic ether (CHEBI:35618) |
| INNs | Source |
|---|---|
| arzoxifene | WHO MedNet |
| arzoxifeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-353381 | ChEMBL |
| LY353381 | ChEMBL |
| Citations |
|---|