EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748780 - pretomanid
| Formula | C14H12F3N3O5 |
| Net Charge | 0 |
| Average Mass | 359.260 |
| Monoisotopic Mass | 359.07291 |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(OC(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C14H12F3N3O5/c15-14(16,17)25-10-3-1-9(2-4-10)7-23-11-5-19-6-12(20(21)22)18-13(19)24-8-11/h1-4,6,11H,5,7-8H2/t11-/m0/s1 |
| InChIKey | ZLHZLMOSPGACSZ-NSHDSACASA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pretomanid (CHEBI:748780) has role antitubercular agent (CHEBI:33231) |
| pretomanid (CHEBI:748780) is a benzyl ether (CHEBI:59859) |
| Synonyms | Source |
|---|---|
| PA 824 | ChEMBL |
| PA-824 | ChEMBL |
| PA824 | ChEMBL |
| Pretomanid | ChEMBL |
| Brand Name | Source |
|---|---|
| Dovprela (previously pretomanid fgk) | ChEMBL |
| Citations |
|---|