EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O4 |
| Net Charge | 0 |
| Average Mass | 367.405 |
| Monoisotopic Mass | 367.15321 |
| SMILES | N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C20H21N3O4/c21-16(10-13-11-22-17-4-2-1-3-15(13)17)19(25)23-18(20(26)27)9-12-5-7-14(24)8-6-12/h1-8,11,16,18,22,24H,9-10,21H2,(H,23,25)(H,26,27)/t16-,18-/m0/s1 |
| InChIKey | TYYLDKGBCJGJGW-WMZOPIPTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Tyr (CHEBI:74878) has role metabolite (CHEBI:25212) |
| Trp-Tyr (CHEBI:74878) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| tryptophyltyrosine | ChEBI |
| L-Trp-L-Tyr | ChEBI |
| WY | ChEBI |
| N-L-Tryptophyl-L-tyrosine | ChemIDplus |
| Tryptophyl-Tyrosine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029095 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4212563 | Reaxys |
| CAS:19653-76-0 | ChemIDplus |