EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748775 - amithiozone
| Formula | C10H12N4OS |
| Net Charge | 0 |
| Average Mass | 236.300 |
| Monoisotopic Mass | 236.07318 |
| SMILES | CC(=O)Nc1ccc(/C=N/NC(N)=S)cc1 |
| InChI | InChI=1S/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ |
| InChIKey | SRVJKTDHMYAMHA-WUXMJOGZSA-N |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amithiozone (CHEBI:748775) has role antibacterial agent (CHEBI:33282) |
| amithiozone (CHEBI:748775) has role antitubercular agent (CHEBI:33231) |
| amithiozone (CHEBI:748775) is a acetamides (CHEBI:22160) |
| amithiozone (CHEBI:748775) is a anilide (CHEBI:13248) |
| INN | Source |
|---|---|
| tioacetazona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Citazone | ChEMBL |
| NSC-3550 | ChEMBL |
| SQ-2321 | ChEMBL |
| TB I-698 | ChEMBL |
| Thibone | ChEMBL |
| Thioacetazone | ChEMBL |
| Citations |
|---|