EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35N7O6S |
| Net Charge | 0 |
| Average Mass | 537.643 |
| Monoisotopic Mass | 537.23695 |
| SMILES | [H][C@]12[C@@H](C)C(S[C@H]3C[C@@H](C(=O)N4CC[C@H](NC(=O)CNC(=N)N)C4)N(C)C3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C23H35N7O6S/c1-10-17-16(11(2)31)21(34)30(17)18(22(35)36)19(10)37-13-6-14(28(3)9-13)20(33)29-5-4-12(8-29)27-15(32)7-26-23(24)25/h10-14,16-17,31H,4-9H2,1-3H3,(H,27,32)(H,35,36)(H4,24,25,26)/t10-,11-,12+,13+,14+,16-,17-/m1/s1 |
| InChIKey | KEDAXBWZURNCHS-GPODMPQUSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tomopenem (CHEBI:748771) is a carbapenems (CHEBI:46633) |
| INN | Source |
|---|---|
| tomopenem | WHO MedNet |
| Synonyms | Source |
|---|---|
| CS-023 | ChEMBL |
| R-115685 | ChEMBL |
| R-1558 | ChEMBL |
| R-1L5685 | ChEMBL |
| RO-4908463 | ChEMBL |
| RO4908463 | ChEMBL |
| Citations |
|---|