EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O3 |
| Net Charge | 0 |
| Average Mass | 303.362 |
| Monoisotopic Mass | 303.15829 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H21N3O3/c1-9(2)14(16(21)22)19-15(20)12(17)7-10-8-18-13-6-4-3-5-11(10)13/h3-6,8-9,12,14,18H,7,17H2,1-2H3,(H,19,20)(H,21,22)/t12-,14-/m0/s1 |
| InChIKey | LWFWZRANSFAJDR-JSGCOSHPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Val (CHEBI:74877) has role metabolite (CHEBI:25212) |
| Trp-Val (CHEBI:74877) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-valine |
| Synonyms | Source |
|---|---|
| tryptophylvaline | ChEBI |
| WV | ChEBI |
| L-Trp-L-Val | ChEBI |
| Tryptophyl-Valine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029096 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8007710 | Reaxys |