EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21F3N2O4S |
| Net Charge | 0 |
| Average Mass | 478.492 |
| Monoisotopic Mass | 478.11741 |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1C(=O)NCc1ccc(OC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C23H21F3N2O4S/c1-13-18(33-20(28-13)15-6-8-16(9-7-15)23(24,25)26)19(29)27-12-14-4-10-17(11-5-14)32-22(2,3)21(30)31/h4-11H,12H2,1-3H3,(H,27,29)(H,30,31) |
| InChIKey | ILUPZUOBHCUBKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gw590735 (CHEBI:748762) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| Gw590735 | ChEMBL |
| GW-590735 | ChEMBL |
| Citations |
|---|