EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N4O3 |
| Net Charge | 0 |
| Average Mass | 390.443 |
| Monoisotopic Mass | 390.16919 |
| SMILES | N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H22N4O3/c23-17(9-13-11-24-18-7-3-1-5-15(13)18)21(27)26-20(22(28)29)10-14-12-25-19-8-4-2-6-16(14)19/h1-8,11-12,17,20,24-25H,9-10,23H2,(H,26,27)(H,28,29)/t17-,20-/m0/s1 |
| InChIKey | NQIHMZLGCZNZBN-PXNSSMCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Trp (CHEBI:74876) has functional parent L-tryptophan (CHEBI:16828) |
| Trp-Trp (CHEBI:74876) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Trp-Trp (CHEBI:74876) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| WW | ChEBI |
| L-Trp-L-Trp | ChEBI |
| tryptophyltryptophan | ChEBI |
| N-L-Tryptophyl-L-tryptophan | ChemIDplus |
| Tryptophyl-Tryptophan | HMDB |
| H-L-Trp-L-Trp-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029094 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4277833 | Reaxys |
| CAS:20696-60-0 | ChemIDplus |
| Citations |
|---|