EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21F2N5O4S |
| Net Charge | 0 |
| Average Mass | 441.460 |
| Monoisotopic Mass | 441.12823 |
| SMILES | COc1ccc(F)c(F)c1C(=O)c1cnc(NC2CCN(S(C)(=O)=O)CC2)nc1N |
| InChI | InChI=1S/C18H21F2N5O4S/c1-29-13-4-3-12(19)15(20)14(13)16(26)11-9-22-18(24-17(11)21)23-10-5-7-25(8-6-10)30(2,27)28/h3-4,9-10H,5-8H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | JRNJNYBQQYBCLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rg-547 (CHEBI:748756) has role antineoplastic agent (CHEBI:35610) |
| rg-547 (CHEBI:748756) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| R 547 | ChEMBL |
| R-547 | ChEMBL |
| RG-547 | ChEMBL |
| Ro 4584820 | ChEMBL |
| Ro-4584820 | ChEMBL |
| RO4584820 | ChEMBL |
| Citations |
|---|