EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11Cl2FN2O2S2 |
| Net Charge | 0 |
| Average Mass | 333.237 |
| Monoisotopic Mass | 331.96230 |
| SMILES | CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C9H11Cl2FN2O2S2/c1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | WURGXGVFSMYFCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichlofluanid (CHEBI:74875) has functional parent sulfamide (CHEBI:29368) |
| dichlofluanid (CHEBI:74875) has role acaricide (CHEBI:22153) |
| dichlofluanid (CHEBI:74875) has role antifungal agrochemical (CHEBI:86328) |
| dichlofluanid (CHEBI:74875) is a organochlorine compound (CHEBI:36683) |
| dichlofluanid (CHEBI:74875) is a organofluorine compound (CHEBI:37143) |
| dichlofluanid (CHEBI:74875) is a phenylsulfamide fungicide (CHEBI:87026) |
| dichlofluanid (CHEBI:74875) is a sulfamides (CHEBI:51871) |
| IUPAC Name |
|---|
| N-{[dichloro(fluoro)methyl]sulfanyl}-N',N'-dimethyl-N-phenylsulfuric diamide |
| Synonyms | Source |
|---|---|
| 1,1-dichloro-N-((dimethylamino)sulfonyl)-1-fluoro-N-phenylmethanesulfenamide | ChemIDplus |
| BAY 47531 | ChemIDplus |
| Bayer 47531 | ChemIDplus |
| dichlofluanide | ChemIDplus |
| N-(Dichlor-fluor-methyl-thio)-N',N'-dimethyl-N-phenylschwefel-saeurediamid | ChemIDplus |
| N-(dichlorofluoromethylthio)-N-(dimethylsulfamoyl)-aniline | ChemIDplus |
| Citations |
|---|