EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6BClO2 |
| Net Charge | 0 |
| Average Mass | 168.388 |
| Monoisotopic Mass | 168.01494 |
| SMILES | OB1OCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C7H6BClO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10H,4H2 |
| InChIKey | HMAFTPZYFJFEHK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| an-2718 (CHEBI:748748) has role antifungal agent (CHEBI:35718) |
| an-2718 (CHEBI:748748) is a organochlorine compound (CHEBI:36683) |
| Synonyms | Source |
|---|---|
| An-2718 | ChEMBL |
| An2718 | ChEMBL |
| Citations |
|---|