EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748745 - apricitabine
| Formula | C8H11N3O3S |
| Net Charge | 0 |
| Average Mass | 229.261 |
| Monoisotopic Mass | 229.05211 |
| SMILES | Nc1ccn([C@H]2CO[C@@H](CO)S2)c(=O)n1 |
| InChI | InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-14-7(3-12)15-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7-/m1/s1 |
| InChIKey | RYMCFYKJDVMSIR-RNFRBKRXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apricitabine (CHEBI:748745) has role anti-HIV agent (CHEBI:64946) |
| apricitabine (CHEBI:748745) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| INNs | Source |
|---|---|
| apricitabina | WHO MedNet |
| apricitabine | WHO MedNet |
| Synonyms | Source |
|---|---|
| AVX-754 | ChEMBL |
| BCH-10618 | ChEMBL |
| BCH-10652, (-)- | ChEMBL |
| SPD -754 | ChEMBL |
| SPD-754 | ChEMBL |
| SPD754 | ChEMBL |
| Citations |
|---|