EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38N4O3S |
| Net Charge | 0 |
| Average Mass | 450.649 |
| Monoisotopic Mass | 450.26646 |
| SMILES | CC(=O)Nc1cccc(N2CCN(CCCCNS(=O)(=O)CC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C23H38N4O3S/c1-20(28)25-22-10-7-11-23(18-22)27-16-14-26(15-17-27)13-6-5-12-24-31(29,30)19-21-8-3-2-4-9-21/h7,10-11,18,21,24H,2-6,8-9,12-17,19H2,1H3,(H,25,28) |
| InChIKey | SPWZXWDPAWDKQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naluzotan (CHEBI:748742) has role anticonvulsant (CHEBI:35623) |
| naluzotan (CHEBI:748742) has role antidepressant (CHEBI:35469) |
| naluzotan (CHEBI:748742) has role anxiolytic drug (CHEBI:35474) |
| naluzotan (CHEBI:748742) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| naluzotan | WHO MedNet |
| Synonym | Source |
|---|---|
| PRX-00023 | ChEMBL |
| Citations |
|---|