EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O3 |
| Net Charge | 0 |
| Average Mass | 351.406 |
| Monoisotopic Mass | 351.15829 |
| SMILES | N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H21N3O3/c21-16(11-14-12-22-17-9-5-4-8-15(14)17)19(24)23-18(20(25)26)10-13-6-2-1-3-7-13/h1-9,12,16,18,22H,10-11,21H2,(H,23,24)(H,25,26)/t16-,18-/m0/s1 |
| InChIKey | IMMPMHKLUUZKAZ-WMZOPIPTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Phe (CHEBI:74874) has role metabolite (CHEBI:25212) |
| Trp-Phe (CHEBI:74874) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| L-Trp-L-Phe | ChEBI |
| tryptophylphenylalanine | ChEBI |
| Tryptophyl-Phenylalanine | HMDB |
| WF | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029090 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6282991 | Reaxys |
| CAS:6686-02-8 | ChemIDplus |