EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27F3N6OS |
| Net Charge | 0 |
| Average Mass | 456.538 |
| Monoisotopic Mass | 456.19192 |
| SMILES | CC(C)(C)c1nc(N2CCN(CCCSc3nccc(O)n3)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H27F3N6OS/c1-19(2,3)17-25-14(20(21,22)23)13-15(26-17)29-10-8-28(9-11-29)7-4-12-31-18-24-6-5-16(30)27-18/h5-6,13H,4,7-12H2,1-3H3,(H,24,27,30) |
| InChIKey | KXVAICSRMHXLJN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abt-925 (CHEBI:748730) has role antipsychotic agent (CHEBI:35476) |
| abt-925 (CHEBI:748730) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| A-437203 | ChEMBL |
| Abt-925 | ChEMBL |
| Citations |
|---|