EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12ClNO4S2 |
| Net Charge | 0 |
| Average Mass | 393.873 |
| Monoisotopic Mass | 392.98963 |
| SMILES | O=C(O)CCN1C(=O)/C(=C/c2ccc(-c3ccc(Cl)cc3)o2)SC1=S |
| InChI | InChI=1S/C17H12ClNO4S2/c18-11-3-1-10(2-4-11)13-6-5-12(23-13)9-14-16(22)19(17(24)25-14)8-7-15(20)21/h1-6,9H,7-8H2,(H,20,21)/b14-9- |
| InChIKey | YZLFZFALAZYTCI-ZROIWOOFSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| claficapavir (CHEBI:748729) has role antiviral agent (CHEBI:22587) |
| claficapavir (CHEBI:748729) is a organochlorine compound (CHEBI:36683) |
| INN | Source |
|---|---|
| claficapavir | WHO MedNet |
| Synonym | Source |
|---|---|
| A-1752 | ChEMBL |
| Citations |
|---|