EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22FN7O |
| Net Charge | 0 |
| Average Mass | 395.442 |
| Monoisotopic Mass | 395.18699 |
| SMILES | CCn1ncnc1COc1nn2c(-c3ccccc3F)nnc2cc1C(C)(C)C |
| InChI | InChI=1S/C20H22FN7O/c1-5-27-17(22-12-23-27)11-29-19-14(20(2,3)4)10-16-24-25-18(28(16)26-19)13-8-6-7-9-15(13)21/h6-10,12H,5,11H2,1-4H3 |
| InChIKey | QKIWQBLNTSQOLY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-0777 (CHEBI:748728) has role antipsychotic agent (CHEBI:35476) |
| mk-0777 (CHEBI:748728) has role anxiolytic drug (CHEBI:35474) |
| mk-0777 (CHEBI:748728) is a triazoles (CHEBI:35727) |
| Synonyms | Source |
|---|---|
| Mk-0777 | ChEMBL |
| MK0777 | ChEMBL |
| TPA-023 | ChEMBL |
| TPA023 | ChEMBL |
| Citations |
|---|