EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H57NO17 |
| Net Charge | 0 |
| Average Mass | 871.930 |
| Monoisotopic Mass | 871.36265 |
| SMILES | [H][C@]12[C@H](OC(=O)c3ccccc3)[C@]34OC(=O)O[C@@]3([H])[C@H](OC(=O)[C@H](O)[C@H](CC(C)C)NC(=O)OC(C)(C)C)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]1(C)[C@@H](O)C[C@@]1([H])OC[C@@]21OC(C)=O)C4(C)C |
| InChI | InChI=1S/C44H57NO17/c1-20(2)17-25(45-38(53)61-40(6,7)8)29(49)37(52)57-30-21(3)28-31(56-22(4)46)33(50)42(11)26(48)18-27-43(19-55-27,60-23(5)47)32(42)35(58-36(51)24-15-13-12-14-16-24)44(41(28,9)10)34(30)59-39(54)62-44/h12-16,20,25-27,29-32,34-35,48-49H,17-19H2,1-11H3,(H,45,53)/t25-,26-,27+,29+,30+,31+,32-,34-,35-,42+,43-,44+/m0/s1 |
| InChIKey | BWKDAMBGCPRVPI-ZQRPHVBESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ortataxel (CHEBI:748727) has functional parent tetracarboxylic acid (CHEBI:35742) |
| ortataxel (CHEBI:748727) has role antineoplastic agent (CHEBI:35610) |
| ortataxel (CHEBI:748727) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| ortataxel | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 59-8862 | ChEMBL |
| BAY-59-8862 | ChEMBL |
| IDN 5109 | ChEMBL |
| IDN-5109 | ChEMBL |
| IDN5109 | ChEMBL |
| SB-T 101131 | ChEMBL |
| Citations |
|---|