EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33N5O2 |
| Net Charge | 0 |
| Average Mass | 411.550 |
| Monoisotopic Mass | 411.26343 |
| SMILES | CCCN1CCN(c2ccc(C(=O)NC3(C(=O)NCC#N)CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-2-14-27-15-17-28(18-16-27)20-8-6-19(7-9-20)21(29)26-23(10-4-3-5-11-23)22(30)25-13-12-24/h6-9H,2-5,10-11,13-18H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | LLCRBOWRJOUJAE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| balicatib (CHEBI:748726) has role anti-inflammatory agent (CHEBI:67079) |
| balicatib (CHEBI:748726) has role bone density conservation agent (CHEBI:50646) |
| balicatib (CHEBI:748726) is a N-acylglycine (CHEBI:16180) |
| INN | Source |
|---|---|
| balicatib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AAE-581 | ChEMBL |
| AAE581 | ChEMBL |
| Citations |
|---|