EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748721 - emricasan
| Formula | C26H27F4N3O7 |
| Net Charge | 0 |
| Average Mass | 569.508 |
| Monoisotopic Mass | 569.17851 |
| SMILES | C[C@H](NC(=O)C(=O)Nc1ccccc1C(C)(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C26H27F4N3O7/c1-12(31-24(38)25(39)32-16-8-6-5-7-13(16)26(2,3)4)23(37)33-17(10-19(35)36)18(34)11-40-22-20(29)14(27)9-15(28)21(22)30/h5-9,12,17H,10-11H2,1-4H3,(H,31,38)(H,32,39)(H,33,37)(H,35,36)/t12-,17-/m0/s1 |
| InChIKey | SCVHJVCATBPIHN-SJCJKPOMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emricasan (CHEBI:748721) has role antiviral agent (CHEBI:22587) |
| emricasan (CHEBI:748721) has role hepatoprotective agent (CHEBI:62868) |
| emricasan (CHEBI:748721) has role hypoglycemic agent (CHEBI:35526) |
| emricasan (CHEBI:748721) is a peptide (CHEBI:16670) |
| INN | Source |
|---|---|
| emricasan | WHO MedNet |
| Synonyms | Source |
|---|---|
| IDN 6556 | ChEMBL |
| IDN-6556 | ChEMBL |
| PF 03491390 | ChEMBL |
| PF-03491390 | ChEMBL |
| VAY-785 | ChEMBL |
| VAY785 | ChEMBL |
| Citations |
|---|