EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N4O3 |
| Net Charge | 0 |
| Average Mass | 332.404 |
| Monoisotopic Mass | 332.18484 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H24N4O3/c18-8-4-3-7-15(17(23)24)21-16(22)13(19)9-11-10-20-14-6-2-1-5-12(11)14/h1-2,5-6,10,13,15,20H,3-4,7-9,18-19H2,(H,21,22)(H,23,24)/t13-,15-/m0/s1 |
| InChIKey | DZHDVYLBNKMLMB-ZFWWWQNUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Lys (CHEBI:74872) has role metabolite (CHEBI:25212) |
| Trp-Lys (CHEBI:74872) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-lysine |
| Synonyms | Source |
|---|---|
| N2-Tryptophyllysine | ChemIDplus |
| L-Trp-L-Lys | ChEBI |
| tryptophyllysine | ChEBI |
| Tryptophyl-Lysine | HMDB |
| WK | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029088 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4764128 | Reaxys |
| CAS:51790-14-8 | ChemIDplus |